PRODUCT Properties
| Melting point: | 94-96° |
| Boiling point: | 509.5±50.0 °C(Predicted) |
| Density | 1.11±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.25±0.60(Predicted) |
| color | White to Off-White |
| λmax | 286nm(EtOH)(lit.) |
| Merck | 14,3703 |
| InChIKey | RFWTZQAOOLFXAY-MTBKBWMONA-N |
| SMILES | C[C@]12CC[C@]3([H])C4C=CC(O)=CC=4CC[C@@]3([H])[C@]1([H])CC[C@@H]2OC(=O)CCCCCC |&1:1,4,15,17,21,r| |
| CAS DataBase Reference | 4956-37-0(CAS DataBase Reference) |
Description and Uses
Estradiol Enanthate has been used as an injectable contraceptive.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H351-H361 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-36 |
