A4288812
Fmoc-Phe-OH , 98% , 35661-40-6
Synonym(s):
N-(9-Fluorenylmethoxycarbonyl)-L -phenylalanine;Fmoc-L -phenylalanine;Fmoc-Phe-OH;N-α-Fmoc-L-phenylalanine
CAS NO.：35661-40-6
Empirical Formula: C24H21NO4
Molecular Weight: 387.43
MDL number: MFCD00037128
EINECS: 252-661-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB196.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-187 °C(lit.) |
| alpha | -38 º (c=1,DMF) |
| Boiling point: | 513.39°C (rough estimate) |
| Density | 1.2379 (rough estimate) |
| refractive index | -39.5 ° (C=1, DMF) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMF (Sparingly, Sonicated), DMSO (Slightly) |
| pka | 3.77±0.10(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D 37°, c = 1 in DMF |
| BRN | 3597808 |
| InChI | InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1 |
| InChIKey | SJVFAHZPLIXNDH-QFIPXVFZSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=CC=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
Description and Uses
(Fmoc-Phe-OH) L-Phenylalanine (P319415) derivative, used in the preparation of peptides and deltorphin derivatives. A potential inhibitor of IGF-I and IGF-Binding Protein-5 complex.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H413 |
| Precautionary statements | P261-P273-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| HS Code | 2924 29 70 |
