PRODUCT Properties
| Melting point: | 248-251 °C(lit.) |
| alpha | -21°(19℃, c=4, H2O) |
| Boiling point: | 456.3±55.0 °C(Predicted) |
| Density | 2.01±0.1 g/cm3(Predicted) |
| refractive index | -20 ° (C=4, H2O) |
| storage temp. | -20°C |
| solubility | DMSO:2.0(Max Conc. mg/mL);8.84(Max Conc. mM) PBS (pH:7.2):1.0(Max Conc. mg/mL);4.42(Max Conc. mM) |
| pka | 12.55±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]19/D 21°, c = 4 in H2O |
| InChI | InChI=1S/C9H10N2O5/c12-3-4-6(14)7-8(15-4)11-2-1-5(13)10-9(11)16-7/h1-2,4,6-8,12,14H,3H2/t4-,6-,7+,8-/m1/s1 |
| InChIKey | UUGITDASWNOAGG-CCXZUQQUSA-N |
| SMILES | C12O[C@@]3([H])[C@H](O)[C@@H](CO)O[C@@]3([H])N1C=CC(=O)N=2 |
Description and Uses
2,2'-Anhydro-1(B-D-arabinofuranosyl)uracil is a research tool for anticancer and antiviral studies. This works by inhibiting uridine phosphorylase, a key enzyme targeted by some antitumor drugs.
Research tool for antiviral and anticancer studies.1
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
