T8901430
β-Estradiol 17-Cypionate , >98.0%(GC) , 313-06-4
Synonym(s):
β-Estradiol 17-cypionate;1,3,5(10)-Estratriene-3,17β-diol 17-cyclopentylpropionate;3,17β-Hydroxy-1,3,5(10)-estratriene 17-cyclopentylpropionate;Depoestradiol
CAS NO.：313-06-4
Empirical Formula: C26H36O3
Molecular Weight: 396.57
MDL number: MFCD00056558
EINECS: 206-237-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1188.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-152° |
| alpha | D25 +45° (chloroform) |
| Boiling point: | 460.24°C (rough estimate) |
| Density | 1.0828 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 10.25±0.60(Predicted) |
| color | White to Off-White |
| InChIKey | UOACKFBJUYNSLK-JCRQLOERNA-N |
| SMILES | C[C@]12CC[C@]3([H])C4C=CC(O)=CC=4CC[C@@]3([H])[C@]1([H])CC[C@@H]2OC(=O)CCC1CCCC1 |&1:1,4,15,17,21,r| |
Description and Uses
Estradiol Cypionate is the cypionate salt form of estradiol, the most potent, naturally produced estrogen. Estradiol Cypionate is present in injectable contraceptive formulations. Used in hormone replacement therapy with potential for improving cognition in post-menopausal women.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H350-H360 |
| Precautionary statements | P201-P280-P301+P312-P302+P352+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | T,Xi |
| Risk Statements | 45-46-61-20/21/22-36/37/38 |
| Safety Statements | 53-22-36/37/39-45-26 |
| WGK Germany | 3 |
| RTECS | KG4600000 |
| HS Code | 29372390 |
