M9035234
Androst-5-en-3-ol-7,17-dioneacetate , 98% , 1449-61-2
CAS NO.：1449-61-2
Empirical Formula: C21H28O4
Molecular Weight: 344.44
MDL number: MFCD00198501
EINECS: 683-490-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB78.40 | In Stock |
|
| 5g | RMB318.40 | In Stock |
|
| 25g | RMB736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184.5-187.5 °C |
| Boiling point: | 479.6±45.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1/C21H28O4/c1-12(22)25-14-6-8-20(2)13(10-14)11-17(23)19-15-4-5-18(24)21(15,3)9-7-16(19)20/h11,14-16,19H,4-10H2,1-3H3/t14-,15-,16-,19-,20-,21-/s3 |
| InChIKey | VVSMJVQHDZUPIL-XHRCOXFGNA-N |
| SMILES | [C@@]12([H])C(=O)C=C3C[C@@H](OC(=O)C)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(CC[C@@]21[H])=O |&1:0,7,14,16,20,25,r| |
Description and Uses
7-Keto Naturalean is a reactant used in the synthesis of C19-steroidal androgen receptor modulators for potential treatment of prostate cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
