M4391853
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctane-1-sulfonicacid , 98% , 27619-97-2
CAS NO.：27619-97-2
Empirical Formula: C8H5F13O3S
Molecular Weight: 428.17
MDL number: MFCD00042455
EINECS: 248-580-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB217.60 | In Stock |
|
| 25g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1,25 g/cm3 |
| vapor pressure | 1.96Pa at 20℃ |
| solubility | Acetone: Slightly soluble,Chloroform: Slightly soluble,DMSO: Slightly soluble,Methanol: Slightly soluble |
| form | A low-melting solid |
| pka | 1.31±0.50(Predicted) |
| Water Solubility | 658g/L at 20℃ |
| InChI | InChI=1S/C8H5F13O3S/c9-3(10,1-2-25(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H,22,23,24) |
| InChIKey | VIONGDJUYAYOPU-UHFFFAOYSA-N |
| SMILES | C(S(O)(=O)=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Description and Uses
1H,1H,2H,2H-Perfluorooctanesulfonic acid (1H,1H,2H,2H-Perfluorooctanesulphonic acid) is an efficient fluorine-containing surfactant without perfluorooctane sulfonic acid, which has the characteristics of high temperature resistance, oxidant resistance, electrolytic stability, etc. It can reduce the concentration of chromic acid in plating workshop and inhibit the precipitation of chromic acid and chromium mist.
1H,1H,2H,2H-Perfluorooctanesulfonic acid is an aliphatic compound for fluorinated surfactant synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P271-P280 |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT, CORROSIVE |
| HS Code | 2904990090 |
