A7290612
(±)-Synephrine , Analysis of standard products, ≥98% , 94-07-5
Synonym(s):
1-(4-Hydroxyphenyl)-2-methylaminoethanol;4-Hydroxy-α-(methylaminomethyl)benzyl alcohol
CAS NO.：94-07-5
Empirical Formula: C9H13NO2
Molecular Weight: 167.21
MDL number: MFCD00002370
EINECS: 202-300-9
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB67.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187 °C (dec.)(lit.) |
| Boiling point: | 295.79°C (rough estimate) |
| Density | 1.1222 (rough estimate) |
| refractive index | 1.4680 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | pKa 9.60±0.02(H2O
t = 25.0±0.5
I = 0.01)(Approximate) |
| color | White to Off-White |
| Merck | 14,9012 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H13NO2/c1-10-6-9(12)7-2-4-8(11)5-3-7/h2-5,9-12H,6H2,1H3/t9-/s3 |
| InChIKey | YRCWQPVGYLYSOX-DJEYLCQNNA-N |
| SMILES | C1(=CC=C(O)C=C1)[C@@H](O)CNC |&1:7,r| |
| LogP | -0.450 |
Description and Uses
(±)-Synephrine has been used as an alkaloid to investigate its in vitro antiviral, antibacterial, antifungal and cytotoxicity activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DO7350000 |
| HS Code | 29225090 |
