PRODUCT Properties
| Melting point: | 120-122.5° (Matsumoto); mp 128-130° (McMorris) |
| Boiling point: | 452.4±45.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMF: Soluble; DMSO: Soluble; Ethanol: Soluble; Methanol: Soluble |
| form | A solid |
| pka | 12.57±0.70(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/C15H20O3/c1-8-10-9(7-13(2,3)12(10)17)11(16)14(4,18)15(8)5-6-15/h7,12,17-18H,5-6H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | QVMDIQLUNODCTG-OCCSQVGLSA-N |
| SMILES | C12([C@](O)(C)C(=O)C3C(=C1C)[C@@H](O)C(C)(C)C=3)CC2 |
Description and Uses
Illudin M is a cytotoxic sesquiterpene from the fungus O. illudens that alkylates DNA. It is cytotoxic to HL-60 human leukemia cells at 6-100 nM. Illudin M was used as a base structure for the development of potential anticancer agents with less toxicity and improved efficacy. It is closely related to illudin S , which has been the focus of additional studies.
Illudin M is a cytotoxic sesquiterpene from Omphalotus illudens and Granulobasidium vellereum. It acts as an alkylating agent that can cause inhibition of cell growth or replication.
