BD1582232
4-Oxo-1,4-dihydroquinoline-3-carboxylic acid , 97% , 13721-01-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB27.20 | In Stock |
|
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB153.60 | In Stock |
|
| 10g | RMB298.40 | In Stock |
|
| 25g | RMB363.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-270℃ |
| Boiling point: | 358℃ |
| Density | 1.429 |
| Flash point: | 171℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 0.80±0.20(Predicted) |
| form | Solid |
| color | Off-White to Light Yellow |
| λmax | 310nm(DMSO)(lit.) |
| InChI | InChI=1S/C10H7NO3/c12-9-6-3-1-2-4-8(6)11-5-7(9)10(13)14/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | ILNJBIQQAIIMEY-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(=O)C(C(O)=O)=C1 |
Description and Uses
4-Oxo-1,4-dihydroquinoline Carboxylic Acid is a novel HIV-1 integrase strand transfer inhibitor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| HS Code | 2933.99.8290 |
| HazardClass | IRRITANT |
