BD0909453
Triisopropylsilylmethacrylate , 97% , 134652-60-1
CAS NO.：134652-60-1
Empirical Formula: C13H26O2Si
Molecular Weight: 242.43
MDL number: MFCD28978458
EINECS: 700-182-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB118.40 | In Stock |
|
| 5g | RMB456.00 | In Stock |
|
| 10g | RMB775.20 | In Stock |
|
| 25g | RMB1554.40 | In Stock |
|
| 100g | RMB6108.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 249.6±9.0 °C(Predicted) |
| Density | 0.870±0.06 g/cm3(Predicted) |
| vapor pressure | 3.9-5.1hPa at 20-25℃ |
| InChI | InChI=1S/C13H26O2Si/c1-9(2)13(14)15-16(10(3)4,11(5)6)12(7)8/h10-12H,1H2,2-8H3 |
| InChIKey | KNNOZYMZRGTZQM-UHFFFAOYSA-N |
| SMILES | C(O[Si](C(C)C)(C(C)C)C(C)C)(=O)C(C)=C |
| LogP | 6.5 |
Description and Uses
Triisopropylsilyl Methacrylate could be used in ship bottom coating as hydrolytic self-polishing polymer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
