BD0613332
2-Fluoropyridine-5-carbaldehyde , 98% , 677728-92-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB379.20 | In Stock |
|
| 10g | RMB654.40 | In Stock |
|
| 25g | RMB1420.80 | In Stock |
|
| 100g | RMB4632.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 229.0±20.0 °C(Predicted) |
| Density | 1.269±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -2.23±0.10(Predicted) |
| form | fused solid |
| color | White |
| InChI | InChI=1S/C6H4FNO/c7-6-2-1-5(4-9)3-8-6/h1-4H |
| InChIKey | PZPNGWWKCSJKOS-UHFFFAOYSA-N |
| SMILES | C1=NC(F)=CC=C1C=O |
Description and Uses
6-Fluoro-3-pyridinecarboxaldehyde is used in the synthetic preparation of biheteroaryl arylamines as selective inhibitors of phosphoinositol 3-kinases (PI3K), which are selective for PI3K over mTOR and have potential use as antitumor agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H332-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| RIDADR | 1993 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
