A7898612
1,3,5-Trifluorobenzene , >98.0%(GC) , 372-38-3
CAS NO.：372-38-3
Empirical Formula: C6H3F3
Molecular Weight: 132.08
MDL number: MFCD00000333
EINECS: 206-751-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB254.40 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -5.5 °C (lit.) |
| Boiling point: | 75-76 °C (lit.) |
| Density | 1.277 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 19 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| Specific Gravity | 1.277 |
| color | Colorless to Almost colorless |
| Water Solubility | Insoluble in water. |
| BRN | 1906457 |
| InChI | InChI=1S/C6H3F3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | JXUKFFRPLNTYIV-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(F)=CC(F)=C1 |
Description and Uses
1,3,5-Trifluorobenzene was used in the synthesis of (?)-epicatechin and its 3-O-gallate.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36-7-33-29-7/9 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29039990 |
