A7447412
Sulfamonomethoxine , >93.0%(HPLC) , 1220-83-3
Synonym(s):
N1-(6-Methoxy-4-pyrimidinyl)sulfanilamide;4-Amino-N-(6-methoxy-4-pyrimidinyl)benzenesulfonamide;4-Methoxy-6-sulfanilamidopyrimidine;SMM
CAS NO.：1220-83-3
Empirical Formula: C11H12N4O3S
Molecular Weight: 280.3
MDL number: MFCD00063466
EINECS: 624-483-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-2060C |
| Boiling point: | 513℃ |
| Density | 1.3936 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| Flash point: | >110°(230°F) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | methanol: soluble10mg/mL |
| pka | pKa 5.94 (Uncertain) |
| form | powder |
| color | white to white with yellow cast |
| Water Solubility | Soluble in water at 10mg/ml with warming. Also soluble in ethanol or methanol |
| BRN | 621128 |
| InChI | InChI=1S/C11H12N4O3S/c1-18-11-6-10(13-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,14,15) |
| InChIKey | WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C=C(OC)N=CN=2)(=O)=O)=CC=C(N)C=C1 |
Description and Uses
antibacterial
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | WP0550000 |
| HazardClass | IRRITANT |
| HS Code | 29350090 |
| Toxicity | LD50 oral in rabbit: > 10gm/kg |
