PRODUCT Properties
| Melting point: | 216-218 °C (lit.) |
| Boiling point: | 194.6°C (rough estimate) |
| Density | 1.1118 (rough estimate) |
| refractive index | 1.5340 (estimate) |
| Flash point: | 240 °C |
| storage temp. | Store below +30°C. |
| solubility | 30g/l |
| pka | 9.17±0.12(Predicted) |
| form | Crystalline Powder |
| color | Brownish to brown-gray |
| Water Solubility | 24 g/L (20 ºC) |
| Merck | 14,2986 |
| BRN | 110232 |
| InChI | InChI=1S/C5H7N3/c6-4-1-2-8-3-5(4)7/h1-3H,7H2,(H2,6,8) |
| InChIKey | OYTKINVCDFNREN-UHFFFAOYSA-N |
| SMILES | C1=NC=CC(N)=C1N |
Description and Uses
It is a potassium channel blocker in nerve terminals. It inhibits potassium channel efflux, increasing the duration of the action potential, which results in an increase in the duration of calcium channel opening and enhanced acetylcholine (ACh) release. Increased ACh availability at the motor end plate allows muscles to contract.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330-H311-H319 |
| Precautionary statements | P260-P264-P280-P302+P352+P312-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | T+,T,Xi |
| Risk Statements | 25-26-36/37/38 |
| Safety Statements | 26-28-36/37/39-45-37/39-28A-36 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | US7600000 |
| F | 10-23 |
| Autoignition Temperature | 480 °C |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29333999 |
| Toxicity | LD50 orally in Rabbit: 47 mg/kg LD50 dermal Rabbit > 200 mg/kg |
