A6176812
4-Nitroindole , 98% , 4769-97-5
CAS NO.：4769-97-5
Empirical Formula: C8H6N2O2
Molecular Weight: 162.15
MDL number: MFCD00010056
EINECS: 689-317-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB44.00 | In Stock |
|
| 5G | RMB132.80 | In Stock |
|
| 25G | RMB608.80 | In Stock |
|
| 100g | RMB2227.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207 °C (lit.) |
| Boiling point: | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetone, Dichloromethane, Ethyl Acetate, Methanol |
| pka | 14.76±0.30(Predicted) |
| form | Granular Powder |
| color | Yellow |
| BRN | 136022 |
| InChI | InChI=1S/C8H6N2O2/c11-10(12)8-3-1-2-7-6(8)4-5-9-7/h1-5,9H |
| InChIKey | LAVZKLJDKGRZJG-UHFFFAOYSA-N |
| SMILES | N1C2=C(C([N+]([O-])=O)=CC=C2)C=C1 |
| CAS DataBase Reference | 4769-97-5(CAS DataBase Reference) |
Description and Uses
4-Nitroindole was used in the synthesis of 1,3,4,5-tetrahydropyrrolo-[4,3,2-de]quinoline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 68 |
| Safety Statements | 45-36/37-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29339900 |
