A6166012
5-Nitroindole , 98% , 6146-52-7
Synonym(s):
NSC 520594
CAS NO.：6146-52-7
Empirical Formula: C8H6N2O2
Molecular Weight: 162.15
MDL number: MFCD00005673
EINECS: 228-153-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB226.40 | In Stock |
|
| 100G | RMB820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-142 °C (lit.) |
| Boiling point: | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Dichloromethane, Ethyl Acetate, Methanol |
| pka | 15.25±0.30(Predicted) |
| form | Crystalline Powder or Needles |
| color | Yellow |
| BRN | 383777 |
| InChI | InChI=1S/C8H6N2O2/c11-10(12)7-1-2-8-6(5-7)3-4-9-8/h1-5,9H |
| InChIKey | OZFPSOBLQZPIAV-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C([N+]([O-])=O)C=C2)C=C1 |
Description and Uses
Reactant for preparation of:
- Pharmaceutically active 2-oxo-1-pyrrolidine analogues
- Tryptophan dioxygenase inhibitors pyridyl-ethenyl-indoles as potential anticancer immunomodulators
- Protein Kinase Inhibitors and antiproliferative agents
- Positive Allosteric Modulators of Metabotropic Glutamate Receptor 4 (mGlu4)
- Antifungal agents
- Cannabinoid receptor type 1 (CB1) antagonists
- Potential anticancer agents
- Potential antivascular agents
- Selective Anti-leukemic agents
- Anti human immunodeficiency virus subtype 1 (HIV-1) agents
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-39-45-36/37 |
| WGK Germany | 3 |
| RTECS | NM1168200 |
| F | 8 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HS Code | 29339900 |
