A5773612
Maleimidoacetic acid N-hydroxysuccinimide ester , 95% , 55750-61-3
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB63.20 | In Stock |
|
| 25mg | RMB119.20 | In Stock |
|
| 100mg | RMB319.20 | In Stock |
|
| 250mg | RMB639.20 | In Stock |
|
| 1g | RMB1719.20 | In Stock |
|
| 5g | RMB5999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-175°C |
| Boiling point: | 430.1±47.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly, Heated) |
| form | Solid |
| pka | -2.69±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2 |
| InChIKey | TYKASZBHFXBROF-UHFFFAOYSA-N |
| SMILES | N1(CC(ON2C(=O)CCC2=O)=O)C(=O)C=CC1=O |
Description and Uses
A hetero-bifunctional cross-linking reagent for the preparation of protein-protein or protein-hapten conjugates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29280000 |
