A4758912
4′-Hydroxy-4-biphenylcarbonitrile , 99% , 19812-93-2
Synonym(s):
4′-Hydroxybiphenyl-4-carbonitrile;4-Hydroxy-4′-cyanobiphenyl
CAS NO.：19812-93-2
Empirical Formula: C13H9NO
Molecular Weight: 195.22
MDL number: MFCD00059625
EINECS: 427-840-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100G | RMB434.40 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191-195 °C (lit.) |
| Boiling point: | 331.88°C (rough estimate) |
| Density | 1.1266 (rough estimate) |
| vapor pressure | 0.022 hPa (20 °C) |
| refractive index | 1.6060 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 12.7g/l no data available |
| form | Crystalline Powder |
| pka | 9.43±0.26(Predicted) |
| color | Light yellow to beige |
| InChI | InChI=1S/C13H9NO/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8,15H |
| InChIKey | MDKUGDVEJBGKLD-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(O)C=C2)=CC=C(C#N)C=C1 |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H411 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P333+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22-36/37-9-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 2926 90 70 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Toxicity | LD50 orally in Rabbit: > 5000 mg/kg |
