A3789812
2,4-Dichloroquinazoline , 95% , 607-68-1
CAS NO.：607-68-1
Empirical Formula: C8H4Cl2N2
Molecular Weight: 199.04
MDL number: MFCD00091950
EINECS: 612-020-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB303.20 | In Stock |
|
| 100G | RMB987.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119.5 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 273.3±23.0 °C(Predicted) |
| Density | 1.486±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -0.43±0.30(Predicted) |
| form | powder |
| color | Yellow |
| InChI | InChI=1S/C8H4Cl2N2/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-4H |
| InChIKey | TUQSVSYUEBNNKQ-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC=C2)=C(Cl)N=C1Cl |
Description and Uses
2,4-Dichloroquinazoline has been used as a reactant for the preparation of 1-methyl-1H-imidazole derivatives as Jak2 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
