A3417412
Diethyl fluoromalonate , ≥97% , 685-88-1
CAS NO.：685-88-1
Empirical Formula: C7H11FO4
Molecular Weight: 178.16
MDL number: MFCD00009139
EINECS: 211-684-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB58.40 | In Stock |
|
| 25G | RMB205.60 | In Stock |
|
| 100g | RMB508.80 | In Stock |
|
| 500g | RMB1288.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 121-122 °C30 mm Hg(lit.) |
| Density | 1.129 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 144 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 10.40±0.46(Predicted) |
| form | Liquid |
| Specific Gravity | 1.129 |
| color | Clear colorless to pale yellow |
| BRN | 1775686 |
| InChI | InChI=1S/C7H11FO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | GOWQBFVDZPZZFA-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)C(OCC)=O |
Description and Uses
The kinetic parameters of diethyl fluoromalonate in hemolysates were used to study carboxylesterase activities in complex systems.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C,T |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-25-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | OO1670000 |
| F | 19 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29171900 |
