A3409512
3,5-Dimethyl-4-nitropyrazole , ≥98.0% , 14531-55-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100g | RMB551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125.0 to 129.0 °C |
| Boiling point: | 325°C(lit.) |
| Density | 1.339±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 10.75±0.50(Predicted) |
| color | White to Almost white |
| λmax | 274nm(CHCl3)(lit.) |
| InChI | InChI=1S/C5H7N3O2/c1-3-5(8(9)10)4(2)7-6-3/h1-2H3,(H,6,7) |
| InChIKey | OFQCJVVJRNPSET-UHFFFAOYSA-N |
| SMILES | N1C(C)=C([N+]([O-])=O)C(C)=N1 |
| CAS DataBase Reference | 14531-55-6(CAS DataBase Reference) |
Description and Uses
As Pyrazoles compound, 3,5-Dimethyl-4-nitro-1H-pyrazole has the key structures in numerous compounds of therapeutic importance. Compounds containing this ring system are known to display diverse pharmacological activities, for example as antimalarial agents , anti-inflammatory agents, and against cardiovascular disease.[1]
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RTECS | UQ6585000 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
