A3311012
6,7-Dimethoxy-3H-quinazolin-4-one , ≥98% , 13794-72-4
CAS NO.：13794-72-4
Empirical Formula: C10H10N2O3
Molecular Weight: 206.2
MDL number: MFCD01570147
EINECS: 635-063-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100g | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 309-311°C |
| Boiling point: | 374.1±52.0 °C(Predicted) |
| Density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 1.46±0.20(Predicted) |
| color | Pale Beige |
| InChI | InChI=1S/C10H10N2O3/c1-14-8-3-6-7(4-9(8)15-2)11-5-12-10(6)13/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | DMSRMHGCZUXCMJ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC)C(OC)=C2)C(=O)NC=1 |
| CAS DataBase Reference | 13794-72-4(CAS DataBase Reference) |
Description and Uses
6,7-Dimethoxy-3,4-dihydroquinazoline-4-one is a white to near-white powder to crystals that is a by-product of the gefitinib manufacturing process and is a gefitinib impurity. It can be used as standard reagent or organic synthesis reagent.
Gefitinib intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-25-24 |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
