2,5-Dibromopyridine , 99% , 624-28-2
CAS NO.：624-28-2
Empirical Formula: C5H3Br2N
Molecular Weight: 236.89
MDL number: MFCD00006221
EINECS: 210-839-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB27.20 | In Stock |
|
| 25G | RMB31.20 | In Stock |
|
| 50g | RMB55.20 | In Stock |
|
| 100G | RMB105.60 | In Stock |
|
| 500g | RMB485.60 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 92-95 °C (lit.) |
| Boiling point: | 235 °C / 772mmHg |
| Density | 2.0383 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 62℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | -1.57±0.10(Predicted) |
| color | Almost white or light beige to brown |
| Water Solubility | insoluble |
| BRN | 109099 |
| InChI | InChI=1S/C5H3Br2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | ZHXUWDPHUQHFOV-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(Br)C=C1 |
Description and Uses
Pyridine and its derivatives are distributed widely by nature. Many plant constituents are as contain pyridine ring compounds in the structure of alkaloids, etc.; they are the bases producing many vital compounds and are indispensable raw materials during medicine, agricultural chemicals, dyestuff, tension-active agents, rubber ingredients, fodder additives, foodstuff additives, tackiness agents, etc. are produced.2,5-dibromo pyridine is an important intermediate of organic synthesis and is mainly used in medicine intermediate, organic synthesis, and organic solvent, can also be applicable to aspects such as DYE PRODUCTION, pesticide production and spices. Selective monolithiation of 2,5-dibromopyridine at either the 2-position or the 5-position is reported. Solvent and concentration strongly influence the selectivity. Coordinating solvents and higher concentration favour the 5-position, while non-coordinating solvents and lower concentration favour the 2-position[1].
2,5-Dibromopyridine (cas# 624-28-2) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302+H312+H332-H315-H319 |
| Precautionary statements | P280a-P304+P340-P305+P351+P338-P405-P501a-P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
