A2585812
Chloro(dodecyl)dimethylsilane , >95.0%(GC) , 66604-31-7
Synonym(s):
Chloro-dimethyl-dodecylsilane;Dimethyldodecylchlorosilane;Dodecyldimethylchlorosilane
CAS NO.：66604-31-7
Empirical Formula: C14H31ClSi
Molecular Weight: 262.93
MDL number: MFCD00043326
EINECS: 266-421-9
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB79.20 | In Stock |
|
| 25ML | RMB279.20 | In Stock |
|
| 100ml | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 291-293 °C |
| Density | 0.865 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 110°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 0.865 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 5240407 |
| InChI | InChI=1S/C14H31ClSi/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15/h16H,3-14H2,1-2H3 |
| InChIKey | WEJOUFHBSYHICH-UHFFFAOYSA-N |
| SMILES | [SiH](CCCCCCCCCCCCCl)(C)C |
| CAS DataBase Reference | 66604-31-7 |
Description and Uses
Chloro(dodecyl)dimethylsilane is a silicon-based surfactant that can be used as an organic solvent. It has been used in the study of cellulose nanomaterials.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319000 |
