A2428312
Chloromethyl Isopropyl Carbonate , 98% , 35180-01-9
CAS NO.：35180-01-9
Empirical Formula: C5H9ClO3
Molecular Weight: 152.58
MDL number: MFCD07375443
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB42.40 | In Stock |
|
| 100G | RMB98.40 | In Stock |
|
| 500G | RMB418.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 66 °C(Press: 16 Torr) |
| Density | 1.14 |
| refractive index | 1.4110-1.4150 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO, Ethyl Acetate (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Stability: | Moisture sensitive |
| InChI | InChI=1S/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
| InChIKey | JHYNXXBAHWPABC-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)OCCl |
Description and Uses
Chloromethyl Isopropyl Carbonate is an antiviral agent and a Tenofovir (T018500) intermediate. Tenofovir is an acyclic phosphonate nucleotide analogue and reverse transcriptase inhibitor used as an anti-HIV agent.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H411 |
| Precautionary statements | P280 |
| Safety Statements | 24/25 |
| RIDADR | 2924 |
| HazardClass | 3/8 |
| PackingGroup | Ⅲ |
| HS Code | 29189900 |
