A1300212
6-Bromo-3-pyridinecarboxaldehyde , 96% , 149806-06-4
CAS NO.：149806-06-4
Empirical Formula: C6H4BrNO
Molecular Weight: 186.01
MDL number: MFCD04115419
EINECS: 629-088-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB76.00 | In Stock |
|
| 25G | RMB248.80 | In Stock |
|
| 100G | RMB962.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 104-110 °C(lit.) |
| Boiling point: | 284° |
| Density | 1.683 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dichloromethane, ether, ethyl acetate and methanol. |
| form | Solid |
| pka | -1.01±0.10(Predicted) |
| color | Pale yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C6H4BrNO/c7-6-2-1-5(4-9)3-8-6/h1-4H |
| InChIKey | PVUKGNBRJFTFNJ-UHFFFAOYSA-N |
| SMILES | C1=NC(Br)=CC=C1C=O |
Description and Uses
A useful synthetic intermediate. 6-Bromonicotinaldehyde is used in wittig reaction. Hydrodehalogenation of 6-bromonicotinaldehyde to produce alcohol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
