A2261512
Chromium picolinate , 98% , 14639-25-9
Synonym(s):
Cr(pic)3;CrPic
CAS NO.：14639-25-9
Empirical Formula: C18H12CrN3O6
Molecular Weight: 418.31
MDL number: MFCD00068715
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB76.80 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100G | RMB524.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | room temp |
| solubility | DMSO (Slightly, Heated) |
| form | Solid |
| color | Dark Red |
| Odor | at 100.00?%. odorless |
| Merck | 14,2236 |
| InChI | InChI=1S/3C6H5NO2.Cr/c3*8-6(9)5-3-1-2-4-7-5;/h3*1-4H,(H,8,9);/q;;;+3/p-3 |
| InChIKey | CBDQOLKNTOMMTL-UHFFFAOYSA-K |
| SMILES | O=C1C2C=CC=CN=2[Cr+3]23([O-]C(=O)C4C=CC=CN2=4)([O-]C(=O)C2C=CC=CN3=2)[O-]1 |
Description and Uses
Chromium picolinate (CrPic), a dietay supplement, may be used to study its potential as a modulator of glucose uptake and the activity of insulin. CrPic is used to study its effects on nuclear factor-κ B (NF-κB) and nuclear factor-E2-related factor-2 (Nrf2) pathways in animals.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-36/37/39-36-26 |
| WGK Germany | 3 |
| RTECS | US5647790 |
| HS Code | 29333990 |
