A1246212
1-Bromo-3,5-dimethyladamantane , 98% , 941-37-7
Synonym(s):
1-Bromo-3,5-dimethyladamantane;1-Bromo-3,5-dimethyltricyclo[3.3.1.13,7]decane
CAS NO.：941-37-7
Empirical Formula: C12H19Br
Molecular Weight: 243.18
MDL number: MFCD00077197
EINECS: 213-378-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB124.80 | In Stock |
|
| 100G | RMB431.20 | In Stock |
|
| 500g | RMB1988.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 201 °C (lit.) |
| Density | 1.224 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 228 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| Specific Gravity | 1.224 |
| BRN | 1927514 |
| InChI | InChI=1S/C12H19Br/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8H2,1-2H3 |
| InChIKey | QUCXLVDIVQWYJR-UHFFFAOYSA-N |
| SMILES | C12(Br)CC3(C)CC(CC(C)(C3)C1)C2 |
Description and Uses
1-Bromo-3,5-dimethyladamantane was used in the one pot synthesis of 1,3-dicarbonyl adamantanes. It was also used in the synthesis of 3,5-dimethyladamantan-1-ol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 34-36 |
| Safety Statements | 26-27-36/37/39-45 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2903890002 |
