A1188012
1,1'-Bis(di-tert-butylphosphino)ferrocene , 98% , 84680-95-5
Synonym(s):
1,1′-Bis(di-tert-butylphosphino)ferrocene
CAS NO.：84680-95-5
Empirical Formula: C26H44FeP210*
Molecular Weight: 474.42
MDL number: MFCD01630818
EINECS: 626-167-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB20.00 | In Stock |
|
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB62.40 | In Stock |
|
| 5g | RMB206.40 | In Stock |
|
| 25g | RMB934.40 | In Stock |
|
| 100g | RMB3084.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-182°C (dec.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | crystal |
| color | orange to red |
| Water Solubility | Insoluble in water. |
| InChI | InChI=1S/2C13H22P.Fe/c2*1-12(2,3)14(13(4,5)6)11-9-7-8-10-11;/h2*7-10H,1-6H3; |
| InChIKey | FPLSJBJGQLJLSV-UHFFFAOYSA-N |
| SMILES | P(C(C)(C)C)(C(C)(C)C)[C]1[CH][CH][CH][CH]1.P(C(C)(C)C)(C(C)(C)C)[C]1[CH][CH][CH][CH]1.[Fe] |^1:9,10,11,12,13,23,24,25,26,27| |
Description and Uses
1,1'-BIS(DI-TERT-BUTYLPHOSPHINO)FERROCENE is an organophosphine compound and can be used as an organometallic ligand.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 29319090 |
