A0727212
2-Adamantanol , 98% , 700-57-2
Synonym(s):
2-Hydroxyadamantane
CAS NO.：700-57-2
Empirical Formula: C10H16O
Molecular Weight: 152.23
MDL number: MFCD00074744
EINECS: 211-846-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB224.80 | In Stock |
|
| 100G | RMB471.20 | In Stock |
|
| 500g | RMB1919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258-262 °C (lit.) |
| Boiling point: | 214.73°C (rough estimate) |
| Density | 0.8544 (rough estimate) |
| refractive index | 1.4880 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 14.93±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | INSOLUBLE |
| BRN | 1903957 |
| InChI | InChI=1S/C10H16O/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-11H,1-5H2 |
| InChIKey | FOWDOWQYRZXQDP-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1O)C2 |
| CAS DataBase Reference | 700-57-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Adamantan-2-ol(700-57-2) |
Description and Uses
The low-temperature X-ray structure of 2-adamantanol ester has been studied.
2-Adamantanol was used to synthesize ester imides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26-25-24 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29061900 |
