A0705512
2-Adamantylamine hydrochloride , 98% , 10523-68-9
Synonym(s):
2-Adamantanamine hydrochloride;2-Aminoadamantane hydrochloride
CAS NO.：10523-68-9
Empirical Formula: C10H18ClN
Molecular Weight: 187.71
MDL number: MFCD00074743
EINECS: 234-074-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.80 | In Stock |
|
| 5G | RMB172.80 | In Stock |
|
| 25G | RMB698.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | soluble |
| BRN | 4297901 |
| InChI | InChI=1/C10H17N.ClH/c11-10-8-2-6-1-7(4-8)5-9(10)3-6;/h6-10H,1-5,11H2;1H/t6-,7+,8-,9+,10?; |
| InChIKey | WLDWDRZITJEWRJ-ZDAMNCSYNA-N |
| SMILES | C1(N)[C@@]2([H])C[C@]3([H])C[C@]([H])(C2)C[C@@]1([H])C3.Cl |&1:2,5,8,12,r| |
| CAS DataBase Reference | 10523-68-9(CAS DataBase Reference) |
Description and Uses
2-Adamantanamine Hydrochloride can be used to prepare CD73 inhibitors to treat CD73-associated diseases, including cancer and immune-related disorders.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| RTECS | AU4375100 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29213000 |
