A0548050
Doxycyclinehydrochloride , ≥95% , 10592-13-9
Synonym(s):
α-6-Deoxy-5-hydroxytetracycline hydrochloride;Doxylin;Idocyklin;Vibramycin hyclate;Vibramycin hydrochloride
CAS NO.：10592-13-9
Empirical Formula: C22H25ClN2O8
Molecular Weight: 480.9
MDL number: MFCD03427564
EINECS: 234-198-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.80 | In Stock |
|
| 5g | RMB77.60 | In Stock |
|
| 25g | RMB100.00 | In Stock |
|
| 100g | RMB314.40 | In Stock |
|
| 500g | RMB1264.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-201℃ |
| Flash point: | 87℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: 50 mg/mL, clear, yellow-green |
| form | powder |
| color | yellow |
| Water Solubility | Soluble in water. |
| BCS Class | 1 |
| InChIKey | RUYHIJHUVHIMIR-PGTYNCOMNA-N |
| SMILES | O[C@@]12C(C(C(=O)N)=C(O)[C@@H](N(C)C)[C@]1([H])[C@H]([C@]1([H])[C@H](C3C=CC=C(O)C=3C(=O)C1=C2O)C)O)=O.Cl |&1:1,9,13,15,16,18,r| |
Description and Uses
Doxycycline hydrochloride is a salt prepared from doxycycline taking advantage of the basic dimethylamino group which protonates and readily forms a salt in hydrochloric acid solutions. The hydrochloride is the preferred formulation for pharmaceutical applications. Like all tetracyclines, doxycycline shows broad spectrum antibacterial and antiprotozoan activity and acts by binding to the 30S and 50S ribosomal subunits, blocking protein synthesis.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H361d |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29413000 |
