PRODUCT Properties
| Melting point: | 122-124 °C |
| Boiling point: | 448.0±45.0 °C(Predicted) |
| Density | 1.09±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 270μg/L at 20℃ |
| InChI | InChI=1S/C20H28O2/c1-3-20-11-10-16-15-7-5-14(22-2)12-13(15)4-6-17(16)18(20)8-9-19(20)21/h5,16-18H,3-4,6-12H2,1-2H3/t16-,17-,18+,20+/m1/s1 |
| InChIKey | PQMRKLSVUBRLLQ-XSYGEPLQSA-N |
| SMILES | C1(OC)CC2=C(CC=1)[C@]1([H])[C@]([H])([C@@]3([H])[C@](CC)(CC1)C(=O)CC3)CC2 |
| LogP | 5.86 at 25℃ |
| CAS DataBase Reference | 2322-77-2(CAS DataBase Reference) |
Description and Uses
Max LMG is a progestin derived steroid and not a 17-alpha alkylated steroid. Max LMG is structurally related to RU-486 and acts as an antiprogesterone, decreasing estrogen-like effects.
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
