![ethyl2-chloro-2-[(4-methoxyphenyl)hydrazinylidene]acetate](https://img.chemicalbook.com/CAS2/GIF/473927-63-8.gif)
M2336035
ethyl2-chloro-2-[(4-methoxyphenyl)hydrazinylidene]acetate , 98% , 473927-63-8
| Pack Size | Price | Stock | Quantity |
| 50g | RMB238.40 | In Stock |
|
| 250g | RMB800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 349.0±44.0 °C(Predicted) |
| Density | 1.23 |
| vapor pressure | 0.008Pa at 25℃ |
| pka | 11.63±0.10(Predicted) |
| InChI | InChI=1S/C11H13ClN2O3/c1-3-17-11(15)10(12)14-13-8-4-6-9(16-2)7-5-8/h4-7,13H,3H2,1-2H3/b14-10- |
| InChIKey | ATNPZEGMKLGIFA-UVTDQMKNSA-N |
| SMILES | C(OCC)(=O)/C(/Cl)=N/NC1=CC=C(OC)C=C1 |
| LogP | 2.53 |
Description and Uses
Ethyl (2Z)-chloro[(4-methoxyphenyl)hydrazono]ethanoate can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development and chemical and pharmaceutical production processes.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331-H341 |
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P302+P352-P304+P340-P308+P313-P310-P330-P361-P403+P233-P405-P501 |
