LN697488
Pentanoic acid,5-bromo-4,4,5,5-tetrafluoro- , ≥95% , 234443-22-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1350.40 | In Stock |
|
| 5g | RMB5030.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 213.6±40.0 °C(Predicted) |
| Density | 1.797±0.06 g/cm3(Predicted) |
| pka | 4.23±0.10(Predicted) |
| form | Solid |
| InChI | InChI=1S/C5H5BrF4O2/c6-5(9,10)4(7,8)2-1-3(11)12/h1-2H2,(H,11,12) |
| InChIKey | OIIFPRVLJLLMOZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCC(F)(F)C(Br)(F)F |
Description and Uses
5-Bromo-4,4,5,5-tetrafluoropentanoic Acid is a halogenated carboxylic acid compound with the common physical and chemical properties of alkyl carboxylic acid compounds. It can undergo esterification reaction with alcohol compounds under acidic conditions, and can also undergo condensation reaction with organic amines to obtain corresponding amide derivatives.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P271-P280 |
| HazardClass | IRRITANT |
| HS Code | 2915907098 |
