LN-865434
BroMocriptine IMpurity E , 0.95 , 2492-53-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 215-217 °C(Solv: chloroform (67-66-3)) |
| Boiling point: | 613.8±55.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3(Predicted) |
| pka | 15.62±0.40(Predicted) |
| InChIKey | OZVBMTJYIDMWIL-CCCBMRMVNA-N |
| SMILES | C1[C@@H](C(N[C@@]2(O[C@@]3(N([C@H](C(N4[C@@]3([H])CCC4)=O)CC(C)C)C2=O)O)C(C)C)=O)CN(C)[C@]2(C=1C1=C3C(C2)=C(Br)NC3=CC=C1)[H] |&1:1,4,6,8,11,31,r| |
Description and Uses
2-Bromolysergamide and other Lysergic Acid derivatives are ergopeptides that interact with liver cytochromes P 450. They have also been known to irreversibly inhibit serotonin containing neurons of the raphe nuclei.
