LN-087016
TRANS-CLOMIPHENE HCL , 99%.9 HPLC , 15690-57-0
CAS NO.：15690-57-0
Empirical Formula: C26H28ClNO
Molecular Weight: 405.96
MDL number: MFCD08060098
EINECS: 213-008-6
| Pack Size | Price | Stock | Quantity |
| 10g | USD240.00 | In Stock |
|
| 50g | USD1000.00 | In Stock |
|
| 100g | USD1900.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149.0-150.5° |
| Boiling point: | 509.0±50.0 °C(Predicted) |
| Density | 1.104±0.06 g/cm3(Predicted) |
| pka | 9.60±0.25(Predicted) |
| InChI | InChI=1S/C26H28ClNO/c1-3-28(4-2)19-20-29-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3/b26-25+ |
| InChIKey | GKIRPKYJQBWNGO-OCEACIFDSA-N |
| SMILES | C(N(CC)CC)COC1=CC=C(/C(/C2=CC=CC=C2)=C(/Cl)\C2=CC=CC=C2)C=C1 |
Description and Uses
Enclomiphene is a synthetic and nonsteroidal antiestrogen. It is the more potent isomer and the one responsible for its ovulation-inducing actions. The half-life of enclomiphene is relatively short, so serum concentrations rise and fall quickly during and after treatment. Antiestrogens represent the first-line treatment strategy in WHO class-2 anovulatory infertility.
trans-Clomiphene is a Clomiphene (C587025) stereoisomer, a synthetic estrogen agonist-antagonist. Gonad-stimulating principle. Treatment for infertility.
