LN-020210
STRYCHNINE NITRATE , >=99% , 66-32-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 295°C |
| Boiling point: | 520.88°C (rough estimate) |
| Density | 1.6270 |
| refractive index | 1.6300 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,8855 |
| InChIKey | PCGVPMHGSJFFTI-AYCNAOTENA-N |
| SMILES | [C@]123[C@@H]4C[C@@]5([H])C(=CCO[C@@]6([H])CC(=O)N(C7C=CC=CC1=7)[C@@]2([H])[C@@]56[H])CN4CC3.[N+]([O-])(=O)O |&1:0,1,3,9,21,23,r| |
| CAS DataBase Reference | 66-32-0(CAS DataBase Reference) |
Description and Uses
Strychnine nitrate is a chemical compound that is made up of strychnine and nitric acid. It is used as a pesticide, particularly for killing small vertebrates such as birds and rodents.
Safety
| Symbol(GHS) |   GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H410-H330-H300 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P273-P391-P501 |
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-50/53-26/28 |
| Safety Statements | 22-36/37/39-45-61-60-28-13 |
| RIDADR | UN 1692 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | WL2450000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
