BD9957547
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonylchloride , 98+% , 25629-50-9
CAS NO.：25629-50-9
Empirical Formula: C11H7Cl2NO2
Molecular Weight: 256.08
MDL number: MFCD00020811
EINECS: 247-137-4
| Pack Size | Price | Stock | Quantity |
| 1000g | RMB490.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 41-42°C |
| Boiling point: | 381.7±42.0 °C(Predicted) |
| Density | 1.381±0.06 g/cm3(Predicted) |
| vapor pressure | 0.001Pa at 25℃ |
| pka | -5.80±0.50(Predicted) |
| form | crystalline solid |
| color | White to off-white |
| Water Solubility | 128.2mg/L at 25℃ |
| Sensitive | Moisture Sensitive |
| BRN | 791931 |
| InChI | InChI=1S/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
| InChIKey | BPDBLWKFVXHGFT-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=C(C)ON=C1C1=CC=CC=C1Cl)=O |
| LogP | 2.61 at 25℃ |
Description and Uses
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride is used for preparing isoxazolyl penicillin derivatives.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-36/45 |
| RIDADR | 3261 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2934999090 |
