BD9899947
4-((2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl)cyclohexanecarboxylicacid , 98% , 64987-82-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB36.00 | In Stock |
|
| 1g | RMB100.80 | In Stock |
|
| 5g | RMB386.40 | In Stock |
|
| 10g | RMB746.40 | In Stock |
|
| 25g | RMB1576.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-158°C |
| Boiling point: | 433.6±18.0 °C(Predicted) |
| Density | 1.329±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 4.80±0.10(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C12H15NO4/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)17/h5-6,8-9H,1-4,7H2,(H,16,17) |
| InChIKey | LQILVUYCDHSGEU-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(CN2C(=O)C=CC2=O)CC1 |
Description and Uses
4-((2,5-Dioxo-2H-pyrrol-1(5H)-yl)methyl)cyclohexanecarboxylic acid contains a maleimide group and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol.
An amino reactive reagent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2925.19.9100 |
