PRODUCT Properties
| Melting point: | 216-217℃ |
| Boiling point: | 449℃ |
| Density | 1.435 |
| Flash point: | 225℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Ethanol (Slightly, Heated), Methanol (Very Slightly, Heated) |
| form | Solid |
| pka | 15.19±0.30(Predicted) |
| color | Dark Red to Brown |
| InChI | InChI=1S/C12H8N2O2/c15-14(16)8-5-6-12-10(7-8)9-3-1-2-4-11(9)13-12/h1-7,13H |
| InChIKey | ZYNHZTIMNJKVLK-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC([N+]([O-])=O)=C2 |
Description and Uses
3-Nitrocarbazole is a nitrated polycyclic aromatic hydrocarbon (PAH) with mutagenic activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
