BD9624831
2-Chloro-5-iodo-3-nitropyridine , 97% , 426463-05-0
CAS NO.：426463-05-0
Empirical Formula: C5H2ClIN2O2
Molecular Weight: 284.44
MDL number: MFCD04038568
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.80 | In Stock |
|
| 1g | RMB76.80 | In Stock |
|
| 5g | RMB137.60 | In Stock |
|
| 25g | RMB663.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-81 °C |
| Boiling point: | 334.0±37.0 °C(Predicted) |
| Density | 2.213±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | -4.74±0.10(Predicted) |
| InChI | InChI=1S/C5H2ClIN2O2/c6-5-4(9(10)11)1-3(7)2-8-5/h1-2H |
| InChIKey | PIJMRJPJERUFNI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(I)C=C1[N+]([O-])=O |
Description and Uses
2-Chloro-5-iodo-3-nitropyridine is used in preparation of nitrogen heterocycles as colony stimulating factor-1 receptor (CSF-1R) inhibitors.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 2933599590 |
