BD9065931
2,6-Dichloro-5-fluoronicotinamide , 98% , 113237-20-0
CAS NO.：113237-20-0
Empirical Formula: C6H3Cl2FN2O
Molecular Weight: 209.01
MDL number: MFCD01571365
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB48.80 | In Stock |
|
| 25g | RMB144.00 | In Stock |
|
| 100g | RMB548.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162 |
| Boiling point: | 259.0±40.0 °C(Predicted) |
| Density | 1.614±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | crystalline solid |
| pka | 13.36±0.50(Predicted) |
| color | White |
| InChI | InChI=1S/C6H3Cl2FN2O/c7-4-2(6(10)12)1-3(9)5(8)11-4/h1H,(H2,10,12) |
| InChIKey | ZVYNUGSPFZCYEV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=C(F)C=C1C(N)=O |
Description and Uses
2,6-Dichloro-5-fluoronicotinamide is a fluorinated pharmaceutical intermediate compound used in the synthesis of Sotorasib and AMG 510. Sotorasib is a RAS GTPase family inhibitor used for the treatment of KRAS-mutated solid tumours including non-small cell lung cancer (NSCLC) and colorectal cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
