BD8856931
H-N-Me-Pro-OH , 97% , 475-11-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB54.40 | In Stock |
|
| 1g | RMB120.80 | In Stock |
|
| 5g | RMB381.60 | In Stock |
|
| 10g | RMB708.80 | In Stock |
|
| 25g | RMB1688.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-116 °C(lit.) |
| Boiling point: | 227℃ |
| Density | 1.153 |
| Flash point: | 91.1℃ |
| refractive index | 1.5000 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 2.37±0.20(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in water and methanol(both 50 mg/ml-clear-colorless solution) |
| InChI | InChI=1S/C6H11NO2/c1-7-4-2-3-5(7)6(8)9/h5H,2-4H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | CWLQUGTUXBXTLF-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@@H]1CCCN1C |
Description and Uses
N-Methyl-L-proline, is an aminoacid which is widely used in pharmaceuticals and food industry.
Safety
| Symbol(GHS) |  GHS07 |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P233-P260-P261-P264-P270-P271-P280-P301+P312-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P330-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
