PRODUCT Properties
| Melting point: | 178-179℃ |
| alpha | D25 +37.5° |
| Boiling point: | 360.05°C (rough estimate) |
| Density | 1.266 |
| refractive index | 1.4315 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Oil to Gel |
| pka | 4.30±0.10(Predicted) |
| color | Colourless |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/s3 |
| InChIKey | GHOKWGTUZJEAQD-KPOCXSGKNA-N |
| SMILES | [C@H](O)(C(=O)NCCC(=O)O)C(C)(C)CO |&1:0,r| |
| LogP | -0.856 (est) |
Description and Uses
Pantothenic Acid is a member of the B complex vitamins; essential vitamin for the biosynthesis of coenzyme A in mammalian cells. Occurs ubiquitously in all animal and plant tissue. The richest common source is liver, but jelly of the queen bee contains 6 times as much as liver. Rice bran and molasses are other good sources.
Safety
| Toxicity | LD50 intraperitoneal in mouse: 1443mg/kg |
