BD7817631
2-(Benzyloxy)acetyl chloride , 95%GC , 19810-31-2
CAS NO.：19810-31-2
Empirical Formula: C9H9ClO2
Molecular Weight: 184.62
MDL number: MFCD00010768
EINECS: 629-534-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB77.60 | In Stock |
|
| 10g | RMB150.40 | In Stock |
|
| 25g | RMB354.40 | In Stock |
|
| 100g | RMB1392.80 | In Stock |
|
| 500g | RMB5217.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120 °C (decomp) |
| Boiling point: | 84-87 °C/0.4 mmHg (lit.) |
| Density | 1.17 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | Powder or Cyrstals |
| color | White |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 1947363 |
| InChI | InChI=1S/C9H9ClO2/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | QISAUDWTBBNJIR-UHFFFAOYSA-N |
| SMILES | C(Cl)(COCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 19810-31-2(CAS DataBase Reference) |
Description and Uses
Benzyloxyacetyl chloride is a reagent used to construct substituted 2-azetidinones for further elaboration into annulated β-lactams. It is a commonly employed reagent for asymmetric synthesis of β-lactams. It is also used in preparation of (S)-3-(methylamino)-3-((R)-pyrrolidin-3-yl)propanenitrile, key intermediate in the preparation of fluoroquinolone antibiotic for respiratory tract infections, non-racemic helicene and β-lactams.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29189900 |
