BD7787431
2-Bromo-4-isopropylaniline , 98% , 51605-97-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB59.20 | In Stock |
|
| 5g | RMB190.40 | In Stock |
|
| 25g | RMB493.60 | In Stock |
|
| 100g | RMB1940.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 116 °C |
| Density | 1.35 |
| refractive index | 1.5750 to 1.5790 |
| Flash point: | 116-118°C/3mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 2.94±0.10(Predicted) |
| Specific Gravity | 1.35 |
| color | Colorless to Yellow |
| Water Solubility | Miscible with dioxane and ethoxyethanol. Immiscible with water. |
| BRN | 2638470 |
| InChI | InChI=1S/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
| InChIKey | WEMDUNBELVTSRP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(C(C)C)C=C1Br |
Description and Uses
2-Bromo-4-isopropylaniline is involved in the preparation of 4-(5-aryl-1, 2, 3, 6-tetrahydropyridino) pyrimidine derivatives and 4-substituted-2-anilinopyrimidine derivatives, which find application as corticotropin releasing factor (CRF) antagonists.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN2810 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2921420090 |
