BD7769931
1-(8-(Benzyloxy)-2-hydroxyquinolin-5-yl)-2-bromoethanone , 97%HPLC , 100331-89-3
CAS NO.：100331-89-3
Empirical Formula: C18H14BrNO3
Molecular Weight: 372.21
MDL number: MFCD07784037
EINECS: 675-817-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB104.80 | In Stock |
|
| 5g | RMB409.60 | In Stock |
|
| 25g | RMB1625.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 192-194oC |
| Boiling point: | 602.6±55.0 °C(Predicted) |
| Density | 1.479±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| pka | 10.38±0.70(Predicted) |
| form | Solid |
| color | White to Pale Beige |
| Stability: | Unstable in DMSO |
| InChI | InChI=1S/C18H14BrNO3/c19-10-15(21)13-6-8-16(18-14(13)7-9-17(22)20-18)23-11-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,22) |
| InChIKey | RVHSDLUBNZBRMH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(C(CBr)=O)=CC=C2OCC2=CC=CC=C2)C=CC1=O |
Description and Uses
8-(benzyloxy)-5-(2-broMoacetyl)quinolin-2(1H)-one can be used in the preparation of phenylethanolamine derivatives as β2 adrenoreceptor agonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
