BD3575245
(1-Bromoethyl)benzene , 97% , 585-71-7
Synonym(s):
α-Methylbenzyl bromide
CAS NO.：585-71-7
Empirical Formula: C8H9Br
Molecular Weight: 185.06
MDL number: MFCD00000139
EINECS: 209-560-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB52.80 | In Stock |
|
| 25g | RMB148.80 | In Stock |
|
| 100g | RMB584.80 | In Stock |
|
| 500g | RMB2812.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -65°C |
| Boiling point: | 94 °C/16 mmHg (lit.) |
| Density | 1.356 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 179 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in alcohol, ether, and benzene. |
| form | Liquid |
| color | Clear yellow to brownish |
| Sensitive | Moisture Sensitive |
| BRN | 507210 |
| InChI | InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 |
| InChIKey | CRRUGYDDEMGVDY-UHFFFAOYSA-N |
| SMILES | C1(C(Br)C)=CC=CC=C1 |
| CAS DataBase Reference | 585-71-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, (1-bromoethyl)-(585-71-7) |
| EPA Substance Registry System | (1-Bromoethyl)benzene (585-71-7) |
Description and Uses
(1-Bromoethyl)benzene has been employed in controlled radical polymerization of styrene, in asymmetric esterification of benzoic acid in the presence of a chiral cyclic guanidine and as initiator in the synthesis of bromine terminated polyp-methoxystyrene and polystyrene via atom transfer radical polymerization.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29036990 |
| Hazardous Substances Data | 585-71-7(Hazardous Substances Data) |
