BD3522145
2,4,6-Trimethylbenzenesulfonohydrazide , 95% , 16182-15-3
Synonym(s):
2-Mesitylenesulfonohydrazide
CAS NO.：16182-15-3
Empirical Formula: C9H14N2O2S
Molecular Weight: 214.28
MDL number: MFCD00007585
EINECS: 240-319-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB101.60 | In Stock |
|
| 25g | RMB439.20 | In Stock |
|
| 100g | RMB1579.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C (dec.) (lit.) |
| Boiling point: | 369.1±52.0 °C(Predicted) |
| Density | 1.217 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 9.58±0.10(Predicted) |
| color | White to off-white |
| BRN | 2118380 |
| InChI | InChI=1S/C9H14N2O2S/c1-6-4-7(2)9(8(3)5-6)14(12,13)11-10/h4-5,11H,10H2,1-3H3 |
| InChIKey | JQUBKTQDNVZHIY-UHFFFAOYSA-N |
| SMILES | C1(S(NN)(=O)=O)=C(C)C=C(C)C=C1C |
| CAS DataBase Reference | 16182-15-3(CAS DataBase Reference) |
Description and Uses
2,4,6-Trimethylbenzenesulfonohydrazide has been used in the synthesis of:
- (E)-N′-(1-((1S*,4aR*,8aR*)-1-hydroxydecahydronaphthalen-4a-yl)ethylidene)-2,4,6-trimethylbenzenesulfonohydrazide
- complanadine alkaloids
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H228-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P261-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | 5-11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 4.8 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29350090 |
